About 4-[(1S,3R)-4,4-difluoro-3-(4-nitropyrazol-1-yl)cyclohexyl]morpholine
4-[(1S,3R)-4,4-difluoro-3-(4-nitropyrazol-1-yl)cyclohexyl]morpholine (PubChem CID 140765922) has the molecular formula C13H18F2N4O3
and a molecular weight of 316.31 g/mol. Its IUPAC name is 4-[(1S,3R)-4,4-difluoro-3-(4-nitropyrazol-1-yl)cyclohexyl]morpholine.
Molecular Properties
| Compound Name | 4-[(1S,3R)-4,4-difluoro-3-(4-nitropyrazol-1-yl)cyclohexyl]morpholine |
| PubChem CID | 140765922 |
| Molecular Formula | C13H18F2N4O3 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 4-[(1S,3R)-4,4-difluoro-3-(4-nitropyrazol-1-yl)cyclohexyl]morpholine |
| SMILES | O=[N+]([O-])c1cnn([C@@H]2C[C@@H](N3CCOCC3)CCC2(F)F)c1 |
| InChI | InChI=1S/C13H18F2N4O3/c14-13(15)2-1-10(17-3-5-22-6-4-17)7-12(13)18-9-11(8-16-18)19(20)21/h8-10,12H,1-7H2/t10-,12+/m0/s1 |
| InChIKey | JKBQLGDMVDOSGQ-CMPLNLGQSA-N |
| XLogP | 1.85 |
| TPSA | 73.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1S,3R)-4,4-difluoro-3-(4-nitropyrazol-1-yl)cyclohexyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1S,3R)-4,4-difluoro-3-(4-nitropyrazol-1-yl)cyclohexyl]morpholine?
The IUPAC name of 4-[(1S,3R)-4,4-difluoro-3-(4-nitropyrazol-1-yl)cyclohexyl]morpholine (CID 140765922) is 4-[(1S,3R)-4,4-difluoro-3-(4-nitropyrazol-1-yl)cyclohexyl]morpholine.
What is the SMILES notation for 4-[(1S,3R)-4,4-difluoro-3-(4-nitropyrazol-1-yl)cyclohexyl]morpholine?
The canonical SMILES for 4-[(1S,3R)-4,4-difluoro-3-(4-nitropyrazol-1-yl)cyclohexyl]morpholine is O=[N+]([O-])c1cnn([C@@H]2C[C@@H](N3CCOCC3)CCC2(F)F)c1.
What is the InChIKey of 4-[(1S,3R)-4,4-difluoro-3-(4-nitropyrazol-1-yl)cyclohexyl]morpholine?
The InChIKey is JKBQLGDMVDOSGQ-CMPLNLGQSA-N. The full InChI is InChI=1S/C13H18F2N4O3/c14-13(15)2-1-10(17-3-5-22-6-4-17)7-12(13)18-9-11(8-16-18)19(20)21/h8-10,12H,1-7H2/t10-,12+/m0/s1.
What are the key properties of 4-[(1S,3R)-4,4-difluoro-3-(4-nitropyrazol-1-yl)cyclohexyl]morpholine?
4-[(1S,3R)-4,4-difluoro-3-(4-nitropyrazol-1-yl)cyclohexyl]morpholine has a molecular weight of 316.31 g/mol, XLogP of 1.85, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1S,3R)-4,4-difluoro-3-(4-nitropyrazol-1-yl)cyclohexyl]morpholine is sourced from PubChem (CID 140765922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).