C15H24O — CID 14076601
(2R,4aS,7R)-1,4a-dimethyl-7-prop-1-en-2-yl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-ol (PubChem CID 14076601) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is (2R,4aS,7R)-1,4a-dimethyl-7-prop-1-en-2-yl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-ol.
| Compound Name | (2R,4aS,7R)-1,4a-dimethyl-7-prop-1-en-2-yl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-ol |
|---|---|
| PubChem CID | 14076601 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | (2R,4aS,7R)-1,4a-dimethyl-7-prop-1-en-2-yl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-ol |
| SMILES | C=C(C)[C@@H]1CC[C@@]2(C)CC[C@@H](O)C(C)=C2C1 |
| InChI | InChI=1S/C15H24O/c1-10(2)12-5-7-15(4)8-6-14(16)11(3)13(15)9-12/h12,14,16H,1,5-9H2,2-4H3/t12-,14-,15+/m1/s1 |
| InChIKey | APWLDLGOYJHNIK-YUELXQCFSA-N |
| XLogP | 3.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|