C12H18FN3O2 — CID 140767080
1-N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-5-fluorobenzene-1,2,4-triamine (PubChem CID 140767080) has the molecular formula C12H18FN3O2 and a molecular weight of 255.29 g/mol. Its IUPAC name is 1-N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-5-fluorobenzene-1,2,4-triamine.
| Compound Name | 1-N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-5-fluorobenzene-1,2,4-triamine |
|---|---|
| PubChem CID | 140767080 |
| Molecular Formula | C12H18FN3O2 |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 1-N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-5-fluorobenzene-1,2,4-triamine |
| SMILES | CC1(C)OC[C@@H](CNc2cc(F)c(N)cc2N)O1 |
| InChI | InChI=1S/C12H18FN3O2/c1-12(2)17-6-7(18-12)5-16-11-3-8(13)9(14)4-10(11)15/h3-4,7,16H,5-6,14-15H2,1-2H3/t7-/m1/s1 |
| InChIKey | QQZLLWIJMYUMLR-SSDOTTSWSA-N |
| XLogP | 1.55 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|