About hafnium;bis(2-methyl-4-propan-2-yl-1H-inden-1-ide)
hafnium;bis(2-methyl-4-propan-2-yl-1H-inden-1-ide) (PubChem CID 140767491) has the molecular formula C26H30Hf-2
and a molecular weight of 521.02 g/mol. Its IUPAC name is hafnium;bis(2-methyl-4-propan-2-yl-1H-inden-1-ide).
Molecular Properties
| Compound Name | hafnium;bis(2-methyl-4-propan-2-yl-1H-inden-1-ide) |
| PubChem CID | 140767491 |
| Molecular Formula | C26H30Hf-2 |
| Molecular Weight | 521.02 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | hafnium;bis(2-methyl-4-propan-2-yl-1H-inden-1-ide) |
| SMILES | Cc1cc2c(C(C)C)cccc2[cH-]1.Cc1cc2c(C(C)C)cccc2[cH-]1.[Hf] |
| InChI | InChI=1S/2C13H15.Hf/c2*1-9(2)12-6-4-5-11-7-10(3)8-13(11)12;/h2*4-9H,1-3H3;/q2*-1; |
| InChIKey | XRDMWBXCUQWWRX-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 521.02 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze hafnium;bis(2-methyl-4-propan-2-yl-1H-inden-1-ide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hafnium;bis(2-methyl-4-propan-2-yl-1H-inden-1-ide)?
The IUPAC name of hafnium;bis(2-methyl-4-propan-2-yl-1H-inden-1-ide) (CID 140767491) is hafnium;bis(2-methyl-4-propan-2-yl-1H-inden-1-ide).
What is the SMILES notation for hafnium;bis(2-methyl-4-propan-2-yl-1H-inden-1-ide)?
The canonical SMILES for hafnium;bis(2-methyl-4-propan-2-yl-1H-inden-1-ide) is Cc1cc2c(C(C)C)cccc2[cH-]1.Cc1cc2c(C(C)C)cccc2[cH-]1.[Hf].
What is the InChIKey of hafnium;bis(2-methyl-4-propan-2-yl-1H-inden-1-ide)?
The InChIKey is XRDMWBXCUQWWRX-UHFFFAOYSA-N. The full InChI is InChI=1S/2C13H15.Hf/c2*1-9(2)12-6-4-5-11-7-10(3)8-13(11)12;/h2*4-9H,1-3H3;/q2*-1;.
What are the key properties of hafnium;bis(2-methyl-4-propan-2-yl-1H-inden-1-ide)?
hafnium;bis(2-methyl-4-propan-2-yl-1H-inden-1-ide) has a molecular weight of 521.02 g/mol, XLogP of 7.98, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hafnium;bis(2-methyl-4-propan-2-yl-1H-inden-1-ide) is sourced from PubChem (CID 140767491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).