C13H11BFNO2 — CID 140767771
1-(8-fluoro-9-oxa-7-azonia-8-boranuidatricyclo[8.4.0.02,7]tetradeca-1(14),2,4,6,10,12-hexaen-8-yl)ethanone (PubChem CID 140767771) has the molecular formula C13H11BFNO2 and a molecular weight of 243.05 g/mol. Its IUPAC name is 1-(8-fluoro-9-oxa-7-azonia-8-boranuidatricyclo[8.4.0.02,7]tetradeca-1(14),2,4,6,10,12-hexaen-8-yl)ethanone.
| Compound Name | 1-(8-fluoro-9-oxa-7-azonia-8-boranuidatricyclo[8.4.0.02,7]tetradeca-1(14),2,4,6,10,12-hexaen-8-yl)ethanone |
|---|---|
| PubChem CID | 140767771 |
| Molecular Formula | C13H11BFNO2 |
| Molecular Weight | 243.05 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 1-(8-fluoro-9-oxa-7-azonia-8-boranuidatricyclo[8.4.0.02,7]tetradeca-1(14),2,4,6,10,12-hexaen-8-yl)ethanone |
| SMILES | CC(=O)[B-]1(F)Oc2ccccc2-c2cccc[n+]21 |
| InChI | InChI=1S/C13H11BFNO2/c1-10(17)14(15)16-9-5-4-7-12(16)11-6-2-3-8-13(11)18-14/h2-9H,1H3 |
| InChIKey | HURXTWVGQYKBJU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.05 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|