C14H13BFNO2 — CID 140767779
1-(8-fluoro-6-methyl-9-oxa-7-azonia-8-boranuidatricyclo[8.4.0.02,7]tetradeca-1(14),2,4,6,10,12-hexaen-8-yl)ethanone (PubChem CID 140767779) has the molecular formula C14H13BFNO2 and a molecular weight of 257.07 g/mol. Its IUPAC name is 1-(8-fluoro-6-methyl-9-oxa-7-azonia-8-boranuidatricyclo[8.4.0.02,7]tetradeca-1(14),2,4,6,10,12-hexaen-8-yl)ethanone.
| Compound Name | 1-(8-fluoro-6-methyl-9-oxa-7-azonia-8-boranuidatricyclo[8.4.0.02,7]tetradeca-1(14),2,4,6,10,12-hexaen-8-yl)ethanone |
|---|---|
| PubChem CID | 140767779 |
| Molecular Formula | C14H13BFNO2 |
| Molecular Weight | 257.07 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 1-(8-fluoro-6-methyl-9-oxa-7-azonia-8-boranuidatricyclo[8.4.0.02,7]tetradeca-1(14),2,4,6,10,12-hexaen-8-yl)ethanone |
| SMILES | CC(=O)[B-]1(F)Oc2ccccc2-c2cccc(C)[n+]21 |
| InChI | InChI=1S/C14H13BFNO2/c1-10-6-5-8-13-12-7-3-4-9-14(12)19-15(16,11(2)18)17(10)13/h3-9H,1-2H3 |
| InChIKey | JYBPYEVJXOMQOA-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.07 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|