About CID 140767880
CID 140767880 (PubChem CID 140767880) has the molecular formula C28H104FO23Si24
and a molecular weight of 1502.18 g/mol.
Molecular Properties
| Compound Name | CID 140767880 |
| PubChem CID | 140767880 |
| Molecular Formula | C28H104FO23Si24 |
| Molecular Weight | 1502.18 g/mol |
| Exact Mass | 1499.14 |
| IUPAC Name | — |
| SMILES | C[Si](O[SiH](C)O[SiH](C)O[SiH](C)O[SiH](C)O[SiH](C)O[SiH](C)O[SiH](C)O[SiH](C)O[SiH](C)O[SiH](C)O[SiH](C)O[SiH](C)O[SiH](C)O[SiH](C)O[SiH](C)O[SiH](C)O[SiH](C)O[SiH](C)O[SiH](C)O[SiH](C)O[Si](C)(C)C)O[Si](C)(F)O[Si](C)(C)C |
| InChI | InChI=1S/C28H104FO23Si24/c1-53(30-54(2)32-56(4)34-58(6)36-60(8)38-62(10)40-64(12)42-66(14)44-68(16)46-70(18)48-72(20)50-74(22,23)24)31-55(3)33-57(5)35-59(7)37-61(9)39-63(11)41-65(13)43-67(15)45-69(17)47-71(19)49-73(21)51-76(28,29)52-75(25,26)27/h53-72H,1-28H3 |
| InChIKey | IWJNKRICKBVMJS-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 212.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 23 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 76 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1502.18 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 23 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze CID 140767880 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140767880?
The IUPAC name of CID 140767880 (CID 140767880) is not available.
What is the SMILES notation for CID 140767880?
The canonical SMILES for CID 140767880 is C[Si](O[SiH](C)O[SiH](C)O[SiH](C)O[SiH](C)O[SiH](C)O[SiH](C)O[SiH](C)O[SiH](C)O[SiH](C)O[SiH](C)O[SiH](C)O[SiH](C)O[SiH](C)O[SiH](C)O[SiH](C)O[SiH](C)O[SiH](C)O[SiH](C)O[SiH](C)O[SiH](C)O[Si](C)(C)C)O[Si](C)(F)O[Si](C)(C)C.
What is the InChIKey of CID 140767880?
The InChIKey is IWJNKRICKBVMJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H104FO23Si24/c1-53(30-54(2)32-56(4)34-58(6)36-60(8)38-62(10)40-64(12)42-66(14)44-68(16)46-70(18)48-72(20)50-74(22,23)24)31-55(3)33-57(5)35-59(7)37-61(9)39-63(11)41-65(13)43-67(15)45-69(17)47-71(19)49-73(21)51-76(28,29)52-75(25,26)27/h53-72H,1-28H3.
What are the key properties of CID 140767880?
CID 140767880 has a molecular weight of 1502.18 g/mol, XLogP of 0.70, 46 rotatable bonds, 0 hydrogen bond donors, and 23 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140767880 is sourced from PubChem (CID 140767880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).