C14H21NSSi — CID 140768167
N-phenyl-2-trimethylsilylsulfanylcyclopentan-1-imine (PubChem CID 140768167) has the molecular formula C14H21NSSi and a molecular weight of 263.48 g/mol. Its IUPAC name is N-phenyl-2-trimethylsilylsulfanylcyclopentan-1-imine.
| Compound Name | N-phenyl-2-trimethylsilylsulfanylcyclopentan-1-imine |
|---|---|
| PubChem CID | 140768167 |
| Molecular Formula | C14H21NSSi |
| Molecular Weight | 263.48 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | N-phenyl-2-trimethylsilylsulfanylcyclopentan-1-imine |
| SMILES | C[Si](C)(C)SC1CCC/C1=N\c1ccccc1 |
| InChI | InChI=1S/C14H21NSSi/c1-17(2,3)16-14-11-7-10-13(14)15-12-8-5-4-6-9-12/h4-6,8-9,14H,7,10-11H2,1-3H3/b15-13+ |
| InChIKey | APRAMFHNFCLBIS-FYWRMAATSA-N |
| XLogP | 4.88 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.48 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|