C11H22O10S2 — CID 140768419
[(2S,3S,4R)-1-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]-4,5-dihydroxy-2-methoxypentan-3-yl] sulfate (PubChem CID 140768419) has the molecular formula C11H22O10S2 and a molecular weight of 378.42 g/mol. Its IUPAC name is [(2S,3S,4R)-1-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]-4,5-dihydroxy-2-methoxypentan-3-yl] sulfate.
| Compound Name | [(2S,3S,4R)-1-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]-4,5-dihydroxy-2-methoxypentan-3-yl] sulfate |
|---|---|
| PubChem CID | 140768419 |
| Molecular Formula | C11H22O10S2 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | [(2S,3S,4R)-1-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]-4,5-dihydroxy-2-methoxypentan-3-yl] sulfate |
| SMILES | CO[C@H](C[S+]1C[C@@H](O)[C@H](O)[C@H]1CO)[C@@H](OS(=O)(=O)[O-])[C@H](O)CO |
| InChI | InChI=1S/C11H22O10S2/c1-20-8(11(6(14)2-12)21-23(17,18)19)5-22-4-7(15)10(16)9(22)3-13/h6-16H,2-5H2,1H3/t6-,7-,8-,9-,10+,11+,22?/m1/s1 |
| InChIKey | ODAZSUBPCLJPIX-BSPVVEQJSA-N |
| XLogP | -4.09 |
| TPSA | 176.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | -4.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|