About N-cyclopentyl-1,1,1-trifluoromethanesulfonamide
N-cyclopentyl-1,1,1-trifluoromethanesulfonamide (PubChem CID 14076853) has the molecular formula C6H10F3NO2S
and a molecular weight of 217.21 g/mol. Its IUPAC name is N-cyclopentyl-1,1,1-trifluoromethanesulfonamide.
Molecular Properties
| Compound Name | N-cyclopentyl-1,1,1-trifluoromethanesulfonamide |
| PubChem CID | 14076853 |
| Molecular Formula | C6H10F3NO2S |
| Molecular Weight | 217.21 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | N-cyclopentyl-1,1,1-trifluoromethanesulfonamide |
| SMILES | O=S(=O)(NC1CCCC1)C(F)(F)F |
| InChI | InChI=1S/C6H10F3NO2S/c7-6(8,9)13(11,12)10-5-3-1-2-4-5/h5,10H,1-4H2 |
| InChIKey | ZIDNFADJQCXAAB-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.21 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-cyclopentyl-1,1,1-trifluoromethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-1,1,1-trifluoromethanesulfonamide?
The IUPAC name of N-cyclopentyl-1,1,1-trifluoromethanesulfonamide (CID 14076853) is N-cyclopentyl-1,1,1-trifluoromethanesulfonamide.
What is the SMILES notation for N-cyclopentyl-1,1,1-trifluoromethanesulfonamide?
The canonical SMILES for N-cyclopentyl-1,1,1-trifluoromethanesulfonamide is O=S(=O)(NC1CCCC1)C(F)(F)F.
What is the InChIKey of N-cyclopentyl-1,1,1-trifluoromethanesulfonamide?
The InChIKey is ZIDNFADJQCXAAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10F3NO2S/c7-6(8,9)13(11,12)10-5-3-1-2-4-5/h5,10H,1-4H2.
What are the key properties of N-cyclopentyl-1,1,1-trifluoromethanesulfonamide?
N-cyclopentyl-1,1,1-trifluoromethanesulfonamide has a molecular weight of 217.21 g/mol, XLogP of 1.37, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-1,1,1-trifluoromethanesulfonamide is sourced from PubChem (CID 14076853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).