About 2H-1,6-naphthyridin-3-one;hydrochloride
2H-1,6-naphthyridin-3-one;hydrochloride (PubChem CID 140768673) has the molecular formula C8H7ClN2O
and a molecular weight of 182.61 g/mol. Its IUPAC name is 2H-1,6-naphthyridin-3-one;hydrochloride.
Molecular Properties
| Compound Name | 2H-1,6-naphthyridin-3-one;hydrochloride |
| PubChem CID | 140768673 |
| Molecular Formula | C8H7ClN2O |
| Molecular Weight | 182.61 g/mol |
| Exact Mass | 182.02 |
| IUPAC Name | 2H-1,6-naphthyridin-3-one;hydrochloride |
| SMILES | Cl.O=C1C=c2cnccc2=NC1 |
| InChI | InChI=1S/C8H6N2O.ClH/c11-7-3-6-4-9-2-1-8(6)10-5-7;/h1-4H,5H2;1H |
| InChIKey | BYOYVFXXYLKUIQ-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 42.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.61 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2H-1,6-naphthyridin-3-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-1,6-naphthyridin-3-one;hydrochloride?
The IUPAC name of 2H-1,6-naphthyridin-3-one;hydrochloride (CID 140768673) is 2H-1,6-naphthyridin-3-one;hydrochloride.
What is the SMILES notation for 2H-1,6-naphthyridin-3-one;hydrochloride?
The canonical SMILES for 2H-1,6-naphthyridin-3-one;hydrochloride is Cl.O=C1C=c2cnccc2=NC1.
What is the InChIKey of 2H-1,6-naphthyridin-3-one;hydrochloride?
The InChIKey is BYOYVFXXYLKUIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O.ClH/c11-7-3-6-4-9-2-1-8(6)10-5-7;/h1-4H,5H2;1H.
What are the key properties of 2H-1,6-naphthyridin-3-one;hydrochloride?
2H-1,6-naphthyridin-3-one;hydrochloride has a molecular weight of 182.61 g/mol, XLogP of -0.51, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-1,6-naphthyridin-3-one;hydrochloride is sourced from PubChem (CID 140768673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).