C10H19F5O2Si — CID 140769735
4-[tert-butyl(dimethyl)silyl]oxy-1,1,1,3,3-pentafluorobutan-2-ol (PubChem CID 140769735) has the molecular formula C10H19F5O2Si and a molecular weight of 294.34 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-1,1,1,3,3-pentafluorobutan-2-ol.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-1,1,1,3,3-pentafluorobutan-2-ol |
|---|---|
| PubChem CID | 140769735 |
| Molecular Formula | C10H19F5O2Si |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-1,1,1,3,3-pentafluorobutan-2-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCC(F)(F)C(O)C(F)(F)F |
| InChI | InChI=1S/C10H19F5O2Si/c1-8(2,3)18(4,5)17-6-9(11,12)7(16)10(13,14)15/h7,16H,6H2,1-5H3 |
| InChIKey | GJMXEKAZIOSEMD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|