C15H34BNO4Si — CID 140769765
[(3S,4S,5R)-3-ethyl-4-hydroxy-5-(2-trimethylsilylethoxymethoxymethyl)piperidin-1-yl]-methylborinic acid (PubChem CID 140769765) has the molecular formula C15H34BNO4Si and a molecular weight of 331.34 g/mol. Its IUPAC name is [(3S,4S,5R)-3-ethyl-4-hydroxy-5-(2-trimethylsilylethoxymethoxymethyl)piperidin-1-yl]-methylborinic acid.
| Compound Name | [(3S,4S,5R)-3-ethyl-4-hydroxy-5-(2-trimethylsilylethoxymethoxymethyl)piperidin-1-yl]-methylborinic acid |
|---|---|
| PubChem CID | 140769765 |
| Molecular Formula | C15H34BNO4Si |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.24 |
| IUPAC Name | [(3S,4S,5R)-3-ethyl-4-hydroxy-5-(2-trimethylsilylethoxymethoxymethyl)piperidin-1-yl]-methylborinic acid |
| SMILES | CC[C@H]1CN(B(C)O)C[C@H](COCOCC[Si](C)(C)C)[C@H]1O |
| InChI | InChI=1S/C15H34BNO4Si/c1-6-13-9-17(16(2)19)10-14(15(13)18)11-21-12-20-7-8-22(3,4)5/h13-15,18-19H,6-12H2,1-5H3/t13-,14+,15-/m0/s1 |
| InChIKey | FMGUBNWRWOETKG-ZNMIVQPWSA-N |
| XLogP | 1.74 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|