About 4-(sulfanylmethyl)-1,3-dioxetan-2-one
4-(sulfanylmethyl)-1,3-dioxetan-2-one (PubChem CID 140769777) has the molecular formula C3H4O3S
and a molecular weight of 120.13 g/mol. Its IUPAC name is 4-(sulfanylmethyl)-1,3-dioxetan-2-one.
Molecular Properties
| Compound Name | 4-(sulfanylmethyl)-1,3-dioxetan-2-one |
| PubChem CID | 140769777 |
| Molecular Formula | C3H4O3S |
| Molecular Weight | 120.13 g/mol |
| Exact Mass | 119.99 |
| IUPAC Name | 4-(sulfanylmethyl)-1,3-dioxetan-2-one |
| SMILES | O=C1OC(CS)O1 |
| InChI | InChI=1S/C3H4O3S/c4-3-5-2(1-7)6-3/h2,7H,1H2 |
| InChIKey | YZXUUKSRJMBKQH-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.13 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(sulfanylmethyl)-1,3-dioxetan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(sulfanylmethyl)-1,3-dioxetan-2-one?
The IUPAC name of 4-(sulfanylmethyl)-1,3-dioxetan-2-one (CID 140769777) is 4-(sulfanylmethyl)-1,3-dioxetan-2-one.
What is the SMILES notation for 4-(sulfanylmethyl)-1,3-dioxetan-2-one?
The canonical SMILES for 4-(sulfanylmethyl)-1,3-dioxetan-2-one is O=C1OC(CS)O1.
What is the InChIKey of 4-(sulfanylmethyl)-1,3-dioxetan-2-one?
The InChIKey is YZXUUKSRJMBKQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4O3S/c4-3-5-2(1-7)6-3/h2,7H,1H2.
What are the key properties of 4-(sulfanylmethyl)-1,3-dioxetan-2-one?
4-(sulfanylmethyl)-1,3-dioxetan-2-one has a molecular weight of 120.13 g/mol, XLogP of 0.41, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(sulfanylmethyl)-1,3-dioxetan-2-one is sourced from PubChem (CID 140769777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).