C34H30O22 — CID 140769867
(3S,4S,5S,6R)-2,3,4,5,6,7-hexahydroxy-2,7-bis(3,4,5-trihydroxybenzoyl)-1,8-bis(3,4,5-trihydroxyphenyl)octane-1,8-dione (PubChem CID 140769867) has the molecular formula C34H30O22 and a molecular weight of 790.59 g/mol. Its IUPAC name is (3S,4S,5S,6R)-2,3,4,5,6,7-hexahydroxy-2,7-bis(3,4,5-trihydroxybenzoyl)-1,8-bis(3,4,5-trihydroxyphenyl)octane-1,8-dione.
| Compound Name | (3S,4S,5S,6R)-2,3,4,5,6,7-hexahydroxy-2,7-bis(3,4,5-trihydroxybenzoyl)-1,8-bis(3,4,5-trihydroxyphenyl)octane-1,8-dione |
|---|---|
| PubChem CID | 140769867 |
| Molecular Formula | C34H30O22 |
| Molecular Weight | 790.59 g/mol |
| Exact Mass | 790.12 |
| IUPAC Name | (3S,4S,5S,6R)-2,3,4,5,6,7-hexahydroxy-2,7-bis(3,4,5-trihydroxybenzoyl)-1,8-bis(3,4,5-trihydroxyphenyl)octane-1,8-dione |
| SMILES | O=C(c1cc(O)c(O)c(O)c1)C(O)(C(=O)c1cc(O)c(O)c(O)c1)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)C(O)(C(=O)c1cc(O)c(O)c(O)c1)C(=O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C34H30O22/c35-13-1-9(2-14(36)21(13)43)27(49)33(55,28(50)10-3-15(37)22(44)16(38)4-10)31(53)25(47)26(48)32(54)34(56,29(51)11-5-17(39)23(45)18(40)6-11)30(52)12-7-19(41)24(46)20(42)8-12/h1-8,25-26,31-32,35-48,53-56H/t25-,26-,31-,32+/m0/s1 |
| InChIKey | BBHGUVIUJHHRMN-NWDGNEFISA-N |
| XLogP | -2.11 |
| TPSA | 432.42 Ų |
| H-Bond Donors | 18 |
| H-Bond Acceptors | 22 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.59 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 18 |
| H-Bond Acceptors ≤ 10 | 22 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|