C11H20N7O4+ — CID 140769976
[(4R,8S)-2,6-diamino-10,10-dihydroxy-8-methyl-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purin-7-ium-4-yl]methyl carbamate (PubChem CID 140769976) has the molecular formula C11H20N7O4+ and a molecular weight of 314.33 g/mol. Its IUPAC name is [(4R,8S)-2,6-diamino-10,10-dihydroxy-8-methyl-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purin-7-ium-4-yl]methyl carbamate.
| Compound Name | [(4R,8S)-2,6-diamino-10,10-dihydroxy-8-methyl-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purin-7-ium-4-yl]methyl carbamate |
|---|---|
| PubChem CID | 140769976 |
| Molecular Formula | C11H20N7O4+ |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | [(4R,8S)-2,6-diamino-10,10-dihydroxy-8-methyl-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purin-7-ium-4-yl]methyl carbamate |
| SMILES | C[C@H]1CC(O)(O)C23NC(N)=NC2[C@H](COC(N)=O)NC(N)=[N+]13 |
| InChI | InChI=1S/C11H19N7O4/c1-4-2-10(20,21)11-6(16-7(12)17-11)5(3-22-9(14)19)15-8(13)18(4)11/h4-6,20-21H,2-3H2,1H3,(H7,12,13,14,15,16,17,19)/p+1/t4-,5-,6?,11?/m0/s1 |
| InChIKey | BENLTROZLJCKIP-CIRGABPHSA-O |
| XLogP | -4.16 |
| TPSA | 184.25 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | -4.16 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|