C16H22N7O5+ — CID 140770028
[(3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-3-ium-9-yl] 4-aminobenzoate (PubChem CID 140770028) has the molecular formula C16H22N7O5+ and a molecular weight of 392.40 g/mol. Its IUPAC name is [(3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-3-ium-9-yl] 4-aminobenzoate.
| Compound Name | [(3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-3-ium-9-yl] 4-aminobenzoate |
|---|---|
| PubChem CID | 140770028 |
| Molecular Formula | C16H22N7O5+ |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | [(3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-3-ium-9-yl] 4-aminobenzoate |
| SMILES | NC1=N[C@@H](CO)[C@@H]2[NH+]=C(N)N[C@]23N1C[C@H](OC(=O)c1ccc(N)cc1)C3(O)O |
| InChI | InChI=1S/C16H21N7O5/c17-8-3-1-7(2-4-8)12(25)28-10-5-23-14(19)20-9(6-24)11-15(23,16(10,26)27)22-13(18)21-11/h1-4,9-11,24,26-27H,5-6,17H2,(H2,19,20)(H3,18,21,22)/p+1/t9-,10-,11-,15-/m0/s1 |
| InChIKey | CNDLUNQDAUDJFC-VEABSNGSSA-O |
| XLogP | -5.46 |
| TPSA | 206.65 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | -5.46 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|