C42H35BN6O2 — CID 140770132
2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 140770132) has the molecular formula C42H35BN6O2 and a molecular weight of 666.59 g/mol. Its IUPAC name is 2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 140770132 |
| Molecular Formula | C42H35BN6O2 |
| Molecular Weight | 666.59 g/mol |
| Exact Mass | 666.29 |
| IUPAC Name | 2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | CC1(C)OB(c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2)OC1(C)C |
| InChI | InChI=1S/C42H35BN6O2/c1-41(2)42(3,4)51-43(50-41)34-26-32(39-46-35(28-17-9-5-10-18-28)44-36(47-39)29-19-11-6-12-20-29)25-33(27-34)40-48-37(30-21-13-7-14-22-30)45-38(49-40)31-23-15-8-16-24-31/h5-27H,1-4H3 |
| InChIKey | ZHPIIMZWIGRJJI-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 95.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.59 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|