C20H24 — CID 140770247
1-ethenyl-2-[(3E,5E,7Z)-3,5,6-trimethylnona-1,3,5,7-tetraen-2-yl]benzene (PubChem CID 140770247) has the molecular formula C20H24 and a molecular weight of 264.41 g/mol. Its IUPAC name is 1-ethenyl-2-[(3E,5E,7Z)-3,5,6-trimethylnona-1,3,5,7-tetraen-2-yl]benzene.
| Compound Name | 1-ethenyl-2-[(3E,5E,7Z)-3,5,6-trimethylnona-1,3,5,7-tetraen-2-yl]benzene |
|---|---|
| PubChem CID | 140770247 |
| Molecular Formula | C20H24 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | 1-ethenyl-2-[(3E,5E,7Z)-3,5,6-trimethylnona-1,3,5,7-tetraen-2-yl]benzene |
| SMILES | C=Cc1ccccc1C(=C)/C(C)=C/C(C)=C(C)/C=C\C |
| InChI | InChI=1S/C20H24/c1-7-11-15(3)16(4)14-17(5)18(6)20-13-10-9-12-19(20)8-2/h7-14H,2,6H2,1,3-5H3/b11-7-,16-15+,17-14+ |
| InChIKey | IPJUATSCGBNUAQ-CIBLRGRJSA-N |
| XLogP | 6.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|