About (1R)-4-trimethylsilyl-2,3-dihydro-1H-inden-1-amine
(1R)-4-trimethylsilyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 140770742) has the molecular formula C12H19NSi
and a molecular weight of 205.38 g/mol. Its IUPAC name is (1R)-4-trimethylsilyl-2,3-dihydro-1H-inden-1-amine.
Molecular Properties
| Compound Name | (1R)-4-trimethylsilyl-2,3-dihydro-1H-inden-1-amine |
| PubChem CID | 140770742 |
| Molecular Formula | C12H19NSi |
| Molecular Weight | 205.38 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | (1R)-4-trimethylsilyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | C[Si](C)(C)c1cccc2c1CC[C@H]2N |
| InChI | InChI=1S/C12H19NSi/c1-14(2,3)12-6-4-5-9-10(12)7-8-11(9)13/h4-6,11H,7-8,13H2,1-3H3/t11-/m1/s1 |
| InChIKey | WQBLMDUSYUDKJC-LLVKDONJSA-N |
| XLogP | 2.18 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (1R)-4-trimethylsilyl-2,3-dihydro-1H-inden-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-4-trimethylsilyl-2,3-dihydro-1H-inden-1-amine?
The IUPAC name of (1R)-4-trimethylsilyl-2,3-dihydro-1H-inden-1-amine (CID 140770742) is (1R)-4-trimethylsilyl-2,3-dihydro-1H-inden-1-amine.
What is the SMILES notation for (1R)-4-trimethylsilyl-2,3-dihydro-1H-inden-1-amine?
The canonical SMILES for (1R)-4-trimethylsilyl-2,3-dihydro-1H-inden-1-amine is C[Si](C)(C)c1cccc2c1CC[C@H]2N.
What is the InChIKey of (1R)-4-trimethylsilyl-2,3-dihydro-1H-inden-1-amine?
The InChIKey is WQBLMDUSYUDKJC-LLVKDONJSA-N. The full InChI is InChI=1S/C12H19NSi/c1-14(2,3)12-6-4-5-9-10(12)7-8-11(9)13/h4-6,11H,7-8,13H2,1-3H3/t11-/m1/s1.
What are the key properties of (1R)-4-trimethylsilyl-2,3-dihydro-1H-inden-1-amine?
(1R)-4-trimethylsilyl-2,3-dihydro-1H-inden-1-amine has a molecular weight of 205.38 g/mol, XLogP of 2.18, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-4-trimethylsilyl-2,3-dihydro-1H-inden-1-amine is sourced from PubChem (CID 140770742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).