About 4-[(E)-2-[3,5-bis[tri(propan-2-yl)silyloxy]phenyl]ethenyl]phenol
4-[(E)-2-[3,5-bis[tri(propan-2-yl)silyloxy]phenyl]ethenyl]phenol (PubChem CID 140771669) has the molecular formula C32H52O3Si2
and a molecular weight of 540.94 g/mol. Its IUPAC name is 4-[(E)-2-[3,5-bis[tri(propan-2-yl)silyloxy]phenyl]ethenyl]phenol.
Molecular Properties
| Compound Name | 4-[(E)-2-[3,5-bis[tri(propan-2-yl)silyloxy]phenyl]ethenyl]phenol |
| PubChem CID | 140771669 |
| Molecular Formula | C32H52O3Si2 |
| Molecular Weight | 540.94 g/mol |
| Exact Mass | 540.35 |
| IUPAC Name | 4-[(E)-2-[3,5-bis[tri(propan-2-yl)silyloxy]phenyl]ethenyl]phenol |
| SMILES | CC(C)[Si](Oc1cc(/C=C/c2ccc(O)cc2)cc(O[Si](C(C)C)(C(C)C)C(C)C)c1)(C(C)C)C(C)C |
| InChI | InChI=1S/C32H52O3Si2/c1-22(2)36(23(3)4,24(5)6)34-31-19-29(14-13-28-15-17-30(33)18-16-28)20-32(21-31)35-37(25(7)8,26(9)10)27(11)12/h13-27,33H,1-12H3/b14-13+ |
| InChIKey | KPOPCURIGJQUPK-BUHFOSPRSA-N |
| XLogP | 10.67 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 540.94 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-2-[3,5-bis[tri(propan-2-yl)silyloxy]phenyl]ethenyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-2-[3,5-bis[tri(propan-2-yl)silyloxy]phenyl]ethenyl]phenol?
The IUPAC name of 4-[(E)-2-[3,5-bis[tri(propan-2-yl)silyloxy]phenyl]ethenyl]phenol (CID 140771669) is 4-[(E)-2-[3,5-bis[tri(propan-2-yl)silyloxy]phenyl]ethenyl]phenol.
What is the SMILES notation for 4-[(E)-2-[3,5-bis[tri(propan-2-yl)silyloxy]phenyl]ethenyl]phenol?
The canonical SMILES for 4-[(E)-2-[3,5-bis[tri(propan-2-yl)silyloxy]phenyl]ethenyl]phenol is CC(C)[Si](Oc1cc(/C=C/c2ccc(O)cc2)cc(O[Si](C(C)C)(C(C)C)C(C)C)c1)(C(C)C)C(C)C.
What is the InChIKey of 4-[(E)-2-[3,5-bis[tri(propan-2-yl)silyloxy]phenyl]ethenyl]phenol?
The InChIKey is KPOPCURIGJQUPK-BUHFOSPRSA-N. The full InChI is InChI=1S/C32H52O3Si2/c1-22(2)36(23(3)4,24(5)6)34-31-19-29(14-13-28-15-17-30(33)18-16-28)20-32(21-31)35-37(25(7)8,26(9)10)27(11)12/h13-27,33H,1-12H3/b14-13+.
What are the key properties of 4-[(E)-2-[3,5-bis[tri(propan-2-yl)silyloxy]phenyl]ethenyl]phenol?
4-[(E)-2-[3,5-bis[tri(propan-2-yl)silyloxy]phenyl]ethenyl]phenol has a molecular weight of 540.94 g/mol, XLogP of 10.67, 12 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-2-[3,5-bis[tri(propan-2-yl)silyloxy]phenyl]ethenyl]phenol is sourced from PubChem (CID 140771669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).