About 2-[(E,3S)-1-iodooct-1-en-3-yl]oxyoxane
2-[(E,3S)-1-iodooct-1-en-3-yl]oxyoxane (PubChem CID 14077178) has the molecular formula C13H23IO2
and a molecular weight of 338.23 g/mol. Its IUPAC name is 2-[(E,3S)-1-iodooct-1-en-3-yl]oxyoxane.
Molecular Properties
| Compound Name | 2-[(E,3S)-1-iodooct-1-en-3-yl]oxyoxane |
| PubChem CID | 14077178 |
| Molecular Formula | C13H23IO2 |
| Molecular Weight | 338.23 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 2-[(E,3S)-1-iodooct-1-en-3-yl]oxyoxane |
| SMILES | CCCCC[C@@H](/C=C/I)OC1CCCCO1 |
| InChI | InChI=1S/C13H23IO2/c1-2-3-4-7-12(9-10-14)16-13-8-5-6-11-15-13/h9-10,12-13H,2-8,11H2,1H3/b10-9+/t12-,13?/m0/s1 |
| InChIKey | FNXUKCWACHTQBU-GOLROBSKSA-N |
| XLogP | 4.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.23 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E,3S)-1-iodooct-1-en-3-yl]oxyoxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E,3S)-1-iodooct-1-en-3-yl]oxyoxane?
The IUPAC name of 2-[(E,3S)-1-iodooct-1-en-3-yl]oxyoxane (CID 14077178) is 2-[(E,3S)-1-iodooct-1-en-3-yl]oxyoxane.
What is the SMILES notation for 2-[(E,3S)-1-iodooct-1-en-3-yl]oxyoxane?
The canonical SMILES for 2-[(E,3S)-1-iodooct-1-en-3-yl]oxyoxane is CCCCC[C@@H](/C=C/I)OC1CCCCO1.
What is the InChIKey of 2-[(E,3S)-1-iodooct-1-en-3-yl]oxyoxane?
The InChIKey is FNXUKCWACHTQBU-GOLROBSKSA-N. The full InChI is InChI=1S/C13H23IO2/c1-2-3-4-7-12(9-10-14)16-13-8-5-6-11-15-13/h9-10,12-13H,2-8,11H2,1H3/b10-9+/t12-,13?/m0/s1.
What are the key properties of 2-[(E,3S)-1-iodooct-1-en-3-yl]oxyoxane?
2-[(E,3S)-1-iodooct-1-en-3-yl]oxyoxane has a molecular weight of 338.23 g/mol, XLogP of 4.43, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E,3S)-1-iodooct-1-en-3-yl]oxyoxane is sourced from PubChem (CID 14077178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).