About [(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-1'-yl)-isothiocyanatomethyl] acetate
[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-1'-yl)-isothiocyanatomethyl] acetate (PubChem CID 140772109) has the molecular formula C24H15NO7S
and a molecular weight of 461.45 g/mol. Its IUPAC name is [(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-1'-yl)-isothiocyanatomethyl] acetate.
Molecular Properties
| Compound Name | [(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-1'-yl)-isothiocyanatomethyl] acetate |
| PubChem CID | 140772109 |
| Molecular Formula | C24H15NO7S |
| Molecular Weight | 461.45 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | [(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-1'-yl)-isothiocyanatomethyl] acetate |
| SMILES | CC(=O)OC(N=C=S)c1cc(O)cc2c1C1(OC(=O)c3ccccc31)c1ccc(O)cc1O2 |
| InChI | InChI=1S/C24H15NO7S/c1-12(26)30-22(25-11-33)16-8-14(28)10-20-21(16)24(18-7-6-13(27)9-19(18)31-20)17-5-3-2-4-15(17)23(29)32-24/h2-10,22,27-28H,1H3 |
| InChIKey | SFWPYPPAMCTRQD-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 114.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 461.45 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-1'-yl)-isothiocyanatomethyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-1'-yl)-isothiocyanatomethyl] acetate?
The IUPAC name of [(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-1'-yl)-isothiocyanatomethyl] acetate (CID 140772109) is [(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-1'-yl)-isothiocyanatomethyl] acetate.
What is the SMILES notation for [(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-1'-yl)-isothiocyanatomethyl] acetate?
The canonical SMILES for [(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-1'-yl)-isothiocyanatomethyl] acetate is CC(=O)OC(N=C=S)c1cc(O)cc2c1C1(OC(=O)c3ccccc31)c1ccc(O)cc1O2.
What is the InChIKey of [(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-1'-yl)-isothiocyanatomethyl] acetate?
The InChIKey is SFWPYPPAMCTRQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H15NO7S/c1-12(26)30-22(25-11-33)16-8-14(28)10-20-21(16)24(18-7-6-13(27)9-19(18)31-20)17-5-3-2-4-15(17)23(29)32-24/h2-10,22,27-28H,1H3.
What are the key properties of [(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-1'-yl)-isothiocyanatomethyl] acetate?
[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-1'-yl)-isothiocyanatomethyl] acetate has a molecular weight of 461.45 g/mol, XLogP of 4.33, 3 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-1'-yl)-isothiocyanatomethyl] acetate is sourced from PubChem (CID 140772109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).