C23H27N3O6S — CID 140772294
[2-[(2,6-dimethyl-4-pyridinyl)methylcarbamoyl]-5-[(1R)-1-[(3S)-3-methyl-2,5-dioxopyrrolidin-3-yl]ethyl]phenyl] methanesulfonate (PubChem CID 140772294) has the molecular formula C23H27N3O6S and a molecular weight of 473.55 g/mol. Its IUPAC name is [2-[(2,6-dimethyl-4-pyridinyl)methylcarbamoyl]-5-[(1R)-1-[(3S)-3-methyl-2,5-dioxopyrrolidin-3-yl]ethyl]phenyl] methanesulfonate.
| Compound Name | [2-[(2,6-dimethyl-4-pyridinyl)methylcarbamoyl]-5-[(1R)-1-[(3S)-3-methyl-2,5-dioxopyrrolidin-3-yl]ethyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 140772294 |
| Molecular Formula | C23H27N3O6S |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | [2-[(2,6-dimethyl-4-pyridinyl)methylcarbamoyl]-5-[(1R)-1-[(3S)-3-methyl-2,5-dioxopyrrolidin-3-yl]ethyl]phenyl] methanesulfonate |
| SMILES | Cc1cc(CNC(=O)c2ccc([C@@H](C)[C@]3(C)CC(=O)NC3=O)cc2OS(C)(=O)=O)cc(C)n1 |
| InChI | InChI=1S/C23H27N3O6S/c1-13-8-16(9-14(2)25-13)12-24-21(28)18-7-6-17(10-19(18)32-33(5,30)31)15(3)23(4)11-20(27)26-22(23)29/h6-10,15H,11-12H2,1-5H3,(H,24,28)(H,26,27,29)/t15-,23+/m1/s1 |
| InChIKey | PIMWSRDPMXXCLA-CMJOXMDJSA-N |
| XLogP | 2.12 |
| TPSA | 131.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|