C26H33FO6Si — CID 140772737
[(3R,4R,5S)-2-acetyloxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(fluoromethyl)oxolan-3-yl] acetate (PubChem CID 140772737) has the molecular formula C26H33FO6Si and a molecular weight of 488.63 g/mol. Its IUPAC name is [(3R,4R,5S)-2-acetyloxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(fluoromethyl)oxolan-3-yl] acetate.
| Compound Name | [(3R,4R,5S)-2-acetyloxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(fluoromethyl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 140772737 |
| Molecular Formula | C26H33FO6Si |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | [(3R,4R,5S)-2-acetyloxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(fluoromethyl)oxolan-3-yl] acetate |
| SMILES | CC(=O)OC1O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](CF)[C@H]1OC(C)=O |
| InChI | InChI=1S/C26H33FO6Si/c1-18(28)31-24-22(16-27)23(33-25(24)32-19(2)29)17-30-34(26(3,4)5,20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-15,22-25H,16-17H2,1-5H3/t22-,23-,24-,25?/m1/s1 |
| InChIKey | LUTIECIAYOWKJH-AWYPOSSQSA-N |
| XLogP | 3.37 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|