C20H16O8 — CID 14077328
2,4,8,10-tetrahydroxy-3-(3-oxobutyl)-2,3-dihydronaphtho[3,2-g][1]benzofuran-6,11-dione (PubChem CID 14077328) has the molecular formula C20H16O8 and a molecular weight of 384.34 g/mol. Its IUPAC name is 2,4,8,10-tetrahydroxy-3-(3-oxobutyl)-2,3-dihydronaphtho[3,2-g][1]benzofuran-6,11-dione.
| Compound Name | 2,4,8,10-tetrahydroxy-3-(3-oxobutyl)-2,3-dihydronaphtho[3,2-g][1]benzofuran-6,11-dione |
|---|---|
| PubChem CID | 14077328 |
| Molecular Formula | C20H16O8 |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 2,4,8,10-tetrahydroxy-3-(3-oxobutyl)-2,3-dihydronaphtho[3,2-g][1]benzofuran-6,11-dione |
| SMILES | CC(=O)CCC1c2c(O)cc3c(c2OC1O)C(=O)c1c(O)cc(O)cc1C3=O |
| InChI | InChI=1S/C20H16O8/c1-7(21)2-3-9-15-13(24)6-11-16(19(15)28-20(9)27)18(26)14-10(17(11)25)4-8(22)5-12(14)23/h4-6,9,20,22-24,27H,2-3H2,1H3 |
| InChIKey | CQHLQVWKORQOPA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|