About sodium (4R)-2-oxo-1,3-oxazolidine-4-carboxylate
sodium (4R)-2-oxo-1,3-oxazolidine-4-carboxylate (PubChem CID 140773335) has the molecular formula C4H4NNaO4
and a molecular weight of 153.07 g/mol. Its IUPAC name is sodium (4R)-2-oxo-1,3-oxazolidine-4-carboxylate.
Molecular Properties
| Compound Name | sodium (4R)-2-oxo-1,3-oxazolidine-4-carboxylate |
| PubChem CID | 140773335 |
| Molecular Formula | C4H4NNaO4 |
| Molecular Weight | 153.07 g/mol |
| Exact Mass | 153.00 |
| IUPAC Name | sodium (4R)-2-oxo-1,3-oxazolidine-4-carboxylate |
| SMILES | O=C1N[C@@H](C(=O)[O-])CO1.[Na+] |
| InChI | InChI=1S/C4H5NO4.Na/c6-3(7)2-1-9-4(8)5-2;/h2H,1H2,(H,5,8)(H,6,7);/q;+1/p-1/t2-;/m1./s1 |
| InChIKey | QBLNTKHLAPPBJQ-HSHFZTNMSA-M |
| XLogP | -5.15 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.07 |
| LogP ≤ 5 | -5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze sodium (4R)-2-oxo-1,3-oxazolidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium (4R)-2-oxo-1,3-oxazolidine-4-carboxylate?
The IUPAC name of sodium (4R)-2-oxo-1,3-oxazolidine-4-carboxylate (CID 140773335) is sodium (4R)-2-oxo-1,3-oxazolidine-4-carboxylate.
What is the SMILES notation for sodium (4R)-2-oxo-1,3-oxazolidine-4-carboxylate?
The canonical SMILES for sodium (4R)-2-oxo-1,3-oxazolidine-4-carboxylate is O=C1N[C@@H](C(=O)[O-])CO1.[Na+].
What is the InChIKey of sodium (4R)-2-oxo-1,3-oxazolidine-4-carboxylate?
The InChIKey is QBLNTKHLAPPBJQ-HSHFZTNMSA-M. The full InChI is InChI=1S/C4H5NO4.Na/c6-3(7)2-1-9-4(8)5-2;/h2H,1H2,(H,5,8)(H,6,7);/q;+1/p-1/t2-;/m1./s1.
What are the key properties of sodium (4R)-2-oxo-1,3-oxazolidine-4-carboxylate?
sodium (4R)-2-oxo-1,3-oxazolidine-4-carboxylate has a molecular weight of 153.07 g/mol, XLogP of -5.15, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium (4R)-2-oxo-1,3-oxazolidine-4-carboxylate is sourced from PubChem (CID 140773335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).