C19H24FN3O2Si — CID 140774100
N-(3-fluoro-4-trimethylsilylphenyl)-2-methoxy-5,6,7,8-tetrahydro-1,6-naphthyridine-5-carboxamide (PubChem CID 140774100) has the molecular formula C19H24FN3O2Si and a molecular weight of 373.50 g/mol. Its IUPAC name is N-(3-fluoro-4-trimethylsilylphenyl)-2-methoxy-5,6,7,8-tetrahydro-1,6-naphthyridine-5-carboxamide.
| Compound Name | N-(3-fluoro-4-trimethylsilylphenyl)-2-methoxy-5,6,7,8-tetrahydro-1,6-naphthyridine-5-carboxamide |
|---|---|
| PubChem CID | 140774100 |
| Molecular Formula | C19H24FN3O2Si |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | N-(3-fluoro-4-trimethylsilylphenyl)-2-methoxy-5,6,7,8-tetrahydro-1,6-naphthyridine-5-carboxamide |
| SMILES | COc1ccc2c(n1)CCNC2C(=O)Nc1ccc([Si](C)(C)C)c(F)c1 |
| InChI | InChI=1S/C19H24FN3O2Si/c1-25-17-8-6-13-15(23-17)9-10-21-18(13)19(24)22-12-5-7-16(14(20)11-12)26(2,3)4/h5-8,11,18,21H,9-10H2,1-4H3,(H,22,24) |
| InChIKey | XWKXQYFILSVVQE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|