About cyclopropyloxycarbamoyl N-tert-butylsulfinylmethanimidate
cyclopropyloxycarbamoyl N-tert-butylsulfinylmethanimidate (PubChem CID 140774662) has the molecular formula C9H16N2O4S
and a molecular weight of 248.30 g/mol. Its IUPAC name is cyclopropyloxycarbamoyl N-tert-butylsulfinylmethanimidate.
Molecular Properties
| Compound Name | cyclopropyloxycarbamoyl N-tert-butylsulfinylmethanimidate |
| PubChem CID | 140774662 |
| Molecular Formula | C9H16N2O4S |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | cyclopropyloxycarbamoyl N-tert-butylsulfinylmethanimidate |
| SMILES | CC(C)(C)S(=O)N=COC(=O)NOC1CC1 |
| InChI | InChI=1S/C9H16N2O4S/c1-9(2,3)16(13)10-6-14-8(12)11-15-7-4-5-7/h6-7H,4-5H2,1-3H3,(H,11,12) |
| InChIKey | AFCLCYZALDYDAT-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze cyclopropyloxycarbamoyl N-tert-butylsulfinylmethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropyloxycarbamoyl N-tert-butylsulfinylmethanimidate?
The IUPAC name of cyclopropyloxycarbamoyl N-tert-butylsulfinylmethanimidate (CID 140774662) is cyclopropyloxycarbamoyl N-tert-butylsulfinylmethanimidate.
What is the SMILES notation for cyclopropyloxycarbamoyl N-tert-butylsulfinylmethanimidate?
The canonical SMILES for cyclopropyloxycarbamoyl N-tert-butylsulfinylmethanimidate is CC(C)(C)S(=O)N=COC(=O)NOC1CC1.
What is the InChIKey of cyclopropyloxycarbamoyl N-tert-butylsulfinylmethanimidate?
The InChIKey is AFCLCYZALDYDAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O4S/c1-9(2,3)16(13)10-6-14-8(12)11-15-7-4-5-7/h6-7H,4-5H2,1-3H3,(H,11,12).
What are the key properties of cyclopropyloxycarbamoyl N-tert-butylsulfinylmethanimidate?
cyclopropyloxycarbamoyl N-tert-butylsulfinylmethanimidate has a molecular weight of 248.30 g/mol, XLogP of 1.30, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropyloxycarbamoyl N-tert-butylsulfinylmethanimidate is sourced from PubChem (CID 140774662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).