About 2-cyclohexyl-4-ethyl-1,3,2-dioxaborolane
2-cyclohexyl-4-ethyl-1,3,2-dioxaborolane (PubChem CID 140774722) has the molecular formula C10H19BO2
and a molecular weight of 182.07 g/mol. Its IUPAC name is 2-cyclohexyl-4-ethyl-1,3,2-dioxaborolane.
Molecular Properties
| Compound Name | 2-cyclohexyl-4-ethyl-1,3,2-dioxaborolane |
| PubChem CID | 140774722 |
| Molecular Formula | C10H19BO2 |
| Molecular Weight | 182.07 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | 2-cyclohexyl-4-ethyl-1,3,2-dioxaborolane |
| SMILES | CCC1COB(C2CCCCC2)O1 |
| InChI | InChI=1S/C10H19BO2/c1-2-10-8-12-11(13-10)9-6-4-3-5-7-9/h9-10H,2-8H2,1H3 |
| InChIKey | WZIBOMSOAUFLKU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.07 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexyl-4-ethyl-1,3,2-dioxaborolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-4-ethyl-1,3,2-dioxaborolane?
The IUPAC name of 2-cyclohexyl-4-ethyl-1,3,2-dioxaborolane (CID 140774722) is 2-cyclohexyl-4-ethyl-1,3,2-dioxaborolane.
What is the SMILES notation for 2-cyclohexyl-4-ethyl-1,3,2-dioxaborolane?
The canonical SMILES for 2-cyclohexyl-4-ethyl-1,3,2-dioxaborolane is CCC1COB(C2CCCCC2)O1.
What is the InChIKey of 2-cyclohexyl-4-ethyl-1,3,2-dioxaborolane?
The InChIKey is WZIBOMSOAUFLKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19BO2/c1-2-10-8-12-11(13-10)9-6-4-3-5-7-9/h9-10H,2-8H2,1H3.
What are the key properties of 2-cyclohexyl-4-ethyl-1,3,2-dioxaborolane?
2-cyclohexyl-4-ethyl-1,3,2-dioxaborolane has a molecular weight of 182.07 g/mol, XLogP of 2.63, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-4-ethyl-1,3,2-dioxaborolane is sourced from PubChem (CID 140774722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).