C32H36F3N3O4Si — CID 140774760
2,2-dimethyl-3-[4-[5-[5-phenyl-4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-2-pyridinyl]phenoxy]propanoic acid (PubChem CID 140774760) has the molecular formula C32H36F3N3O4Si and a molecular weight of 611.74 g/mol. Its IUPAC name is 2,2-dimethyl-3-[4-[5-[5-phenyl-4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-2-pyridinyl]phenoxy]propanoic acid.
| Compound Name | 2,2-dimethyl-3-[4-[5-[5-phenyl-4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-2-pyridinyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 140774760 |
| Molecular Formula | C32H36F3N3O4Si |
| Molecular Weight | 611.74 g/mol |
| Exact Mass | 611.24 |
| IUPAC Name | 2,2-dimethyl-3-[4-[5-[5-phenyl-4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-2-pyridinyl]phenoxy]propanoic acid |
| SMILES | CC(C)(COc1ccc(-c2ccc(-c3nc(C(F)(F)F)c(-c4ccccc4)n3COCC[Si](C)(C)C)cn2)cc1)C(=O)O |
| InChI | InChI=1S/C32H36F3N3O4Si/c1-31(2,30(39)40)20-42-25-14-11-22(12-15-25)26-16-13-24(19-36-26)29-37-28(32(33,34)35)27(23-9-7-6-8-10-23)38(29)21-41-17-18-43(3,4)5/h6-16,19H,17-18,20-21H2,1-5H3,(H,39,40) |
| InChIKey | IWWFUZIUJUYVCV-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.74 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|