C28H38F3N4OSi+ — CID 140774771
2-[[5-[4-[6-(4-ethylcyclohexyl)-3-pyridinyl]phenyl]-3-(trifluoromethyl)-1H-1,2,4-triazol-2-ium-2-yl]methoxy]ethyl-trimethylsilane (PubChem CID 140774771) has the molecular formula C28H38F3N4OSi+ and a molecular weight of 531.72 g/mol. Its IUPAC name is 2-[[5-[4-[6-(4-ethylcyclohexyl)-3-pyridinyl]phenyl]-3-(trifluoromethyl)-1H-1,2,4-triazol-2-ium-2-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-[4-[6-(4-ethylcyclohexyl)-3-pyridinyl]phenyl]-3-(trifluoromethyl)-1H-1,2,4-triazol-2-ium-2-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 140774771 |
| Molecular Formula | C28H38F3N4OSi+ |
| Molecular Weight | 531.72 g/mol |
| Exact Mass | 531.28 |
| IUPAC Name | 2-[[5-[4-[6-(4-ethylcyclohexyl)-3-pyridinyl]phenyl]-3-(trifluoromethyl)-1H-1,2,4-triazol-2-ium-2-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CCC1CCC(c2ccc(-c3ccc(-c4nc(C(F)(F)F)[n+](COCC[Si](C)(C)C)[nH]4)cc3)cn2)CC1 |
| InChI | InChI=1S/C28H37F3N4OSi/c1-5-20-6-8-22(9-7-20)25-15-14-24(18-32-25)21-10-12-23(13-11-21)26-33-27(28(29,30)31)35(34-26)19-36-16-17-37(2,3)4/h10-15,18,20,22H,5-9,16-17,19H2,1-4H3/p+1 |
| InChIKey | XPMDVFQHUUSAPK-UHFFFAOYSA-O |
| XLogP | 7.44 |
| TPSA | 54.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.72 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|