C28H30MnN4O4+2 — CID 140775404
2-[[2-[(2,5-dihydroxyphenyl)methyl-(pyridin-2-ylmethyl)amino]ethyl-(pyridin-2-ylmethyl)amino]methyl]benzene-1,4-diol;manganese(2+) (PubChem CID 140775404) has the molecular formula C28H30MnN4O4+2 and a molecular weight of 541.51 g/mol. Its IUPAC name is 2-[[2-[(2,5-dihydroxyphenyl)methyl-(pyridin-2-ylmethyl)amino]ethyl-(pyridin-2-ylmethyl)amino]methyl]benzene-1,4-diol;manganese(2+).
| Compound Name | 2-[[2-[(2,5-dihydroxyphenyl)methyl-(pyridin-2-ylmethyl)amino]ethyl-(pyridin-2-ylmethyl)amino]methyl]benzene-1,4-diol;manganese(2+) |
|---|---|
| PubChem CID | 140775404 |
| Molecular Formula | C28H30MnN4O4+2 |
| Molecular Weight | 541.51 g/mol |
| Exact Mass | 541.16 |
| IUPAC Name | 2-[[2-[(2,5-dihydroxyphenyl)methyl-(pyridin-2-ylmethyl)amino]ethyl-(pyridin-2-ylmethyl)amino]methyl]benzene-1,4-diol;manganese(2+) |
| SMILES | Oc1ccc(O)c(CN(CCN(Cc2ccccn2)Cc2cc(O)ccc2O)Cc2ccccn2)c1.[Mn+2] |
| InChI | InChI=1S/C28H30N4O4.Mn/c33-25-7-9-27(35)21(15-25)17-31(19-23-5-1-3-11-29-23)13-14-32(20-24-6-2-4-12-30-24)18-22-16-26(34)8-10-28(22)36;/h1-12,15-16,33-36H,13-14,17-20H2;/q;+2 |
| InChIKey | OYTLPBVOKDPJSB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|