C38H22N4 — CID 140775511
9-[3-[3-(3-isocyanocarbazol-9-yl)phenyl]phenyl]carbazole-3-carbonitrile (PubChem CID 140775511) has the molecular formula C38H22N4 and a molecular weight of 534.62 g/mol. Its IUPAC name is 9-[3-[3-(3-isocyanocarbazol-9-yl)phenyl]phenyl]carbazole-3-carbonitrile.
| Compound Name | 9-[3-[3-(3-isocyanocarbazol-9-yl)phenyl]phenyl]carbazole-3-carbonitrile |
|---|---|
| PubChem CID | 140775511 |
| Molecular Formula | C38H22N4 |
| Molecular Weight | 534.62 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | 9-[3-[3-(3-isocyanocarbazol-9-yl)phenyl]phenyl]carbazole-3-carbonitrile |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1ccccc1n2-c1cccc(-c2cccc(-n3c4ccccc4c4cc(C#N)ccc43)c2)c1 |
| InChI | InChI=1S/C38H22N4/c1-40-28-17-19-38-34(23-28)32-13-3-5-15-36(32)42(38)30-11-7-9-27(22-30)26-8-6-10-29(21-26)41-35-14-4-2-12-31(35)33-20-25(24-39)16-18-37(33)41/h2-23H |
| InChIKey | MFNYEERFLYJUQQ-UHFFFAOYSA-N |
| XLogP | 9.97 |
| TPSA | 38.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.62 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|