C27H33N5OSi — CID 140775638
[6-[3-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]-5,7-dihydrocyclopenta[c]pyridin-6-yl]methanamine (PubChem CID 140775638) has the molecular formula C27H33N5OSi and a molecular weight of 471.68 g/mol. Its IUPAC name is [6-[3-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]-5,7-dihydrocyclopenta[c]pyridin-6-yl]methanamine.
| Compound Name | [6-[3-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]-5,7-dihydrocyclopenta[c]pyridin-6-yl]methanamine |
|---|---|
| PubChem CID | 140775638 |
| Molecular Formula | C27H33N5OSi |
| Molecular Weight | 471.68 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | [6-[3-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]-5,7-dihydrocyclopenta[c]pyridin-6-yl]methanamine |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(-c3cccc(C4(CN)Cc5ccncc5C4)c3)ncnc21 |
| InChI | InChI=1S/C27H33N5OSi/c1-34(2,3)12-11-33-19-32-10-8-24-25(30-18-31-26(24)32)20-5-4-6-23(13-20)27(17-28)14-21-7-9-29-16-22(21)15-27/h4-10,13,16,18H,11-12,14-15,17,19,28H2,1-3H3 |
| InChIKey | AXXVLFWAWPWGEL-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.68 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|