C31H32N4O4 — CID 140775742
tert-butyl N-(3'-oxospiro[2-oxa-8,18-diazapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),3(12),4(9),10,15,17(22)-hexaene-13,1'-isoindole]-2'-yl)carbamate (PubChem CID 140775742) has the molecular formula C31H32N4O4 and a molecular weight of 524.62 g/mol. Its IUPAC name is tert-butyl N-(3'-oxospiro[2-oxa-8,18-diazapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),3(12),4(9),10,15,17(22)-hexaene-13,1'-isoindole]-2'-yl)carbamate.
| Compound Name | tert-butyl N-(3'-oxospiro[2-oxa-8,18-diazapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),3(12),4(9),10,15,17(22)-hexaene-13,1'-isoindole]-2'-yl)carbamate |
|---|---|
| PubChem CID | 140775742 |
| Molecular Formula | C31H32N4O4 |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | tert-butyl N-(3'-oxospiro[2-oxa-8,18-diazapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),3(12),4(9),10,15,17(22)-hexaene-13,1'-isoindole]-2'-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NN1C(=O)c2ccccc2C12c1ccc3c(c1Oc1c2ccc2c1CCCN2)CCCN3 |
| InChI | InChI=1S/C31H32N4O4/c1-30(2,3)39-29(37)34-35-28(36)18-8-4-5-11-21(18)31(35)22-12-14-24-19(9-6-16-32-24)26(22)38-27-20-10-7-17-33-25(20)15-13-23(27)31/h4-5,8,11-15,32-33H,6-7,9-10,16-17H2,1-3H3,(H,34,37) |
| InChIKey | XRWUDSDHJKRHMT-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|