C45H50O13Si — CID 14077585
methyl (2S,4S,5R,6S)-5-benzoyloxy-4-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-6-[(1R,2R)-1,2,3-tribenzoyloxypropyl]oxane-2-carboxylate (PubChem CID 14077585) has the molecular formula C45H50O13Si and a molecular weight of 826.97 g/mol. Its IUPAC name is methyl (2S,4S,5R,6S)-5-benzoyloxy-4-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-6-[(1R,2R)-1,2,3-tribenzoyloxypropyl]oxane-2-carboxylate.
| Compound Name | methyl (2S,4S,5R,6S)-5-benzoyloxy-4-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-6-[(1R,2R)-1,2,3-tribenzoyloxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 14077585 |
| Molecular Formula | C45H50O13Si |
| Molecular Weight | 826.97 g/mol |
| Exact Mass | 826.30 |
| IUPAC Name | methyl (2S,4S,5R,6S)-5-benzoyloxy-4-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-6-[(1R,2R)-1,2,3-tribenzoyloxypropyl]oxane-2-carboxylate |
| SMILES | COC(=O)[C@]1(OC)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](OC(=O)c2ccccc2)[C@H]([C@H](OC(=O)c2ccccc2)[C@@H](COC(=O)c2ccccc2)OC(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C45H50O13Si/c1-44(2,3)59(6,7)58-34-28-45(52-5,43(50)51-4)57-38(36(34)55-41(48)32-24-16-10-17-25-32)37(56-42(49)33-26-18-11-19-27-33)35(54-40(47)31-22-14-9-15-23-31)29-53-39(46)30-20-12-8-13-21-30/h8-27,34-38H,28-29H2,1-7H3/t34-,35+,36-,37+,38+,45-/m0/s1 |
| InChIKey | OKPIRQOCPGRDGG-VLRYXGHWSA-N |
| XLogP | 7.22 |
| TPSA | 159.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.97 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|