About (7-carbamoyl-2,3-dimethyl-1H-indol-4-yl) piperidine-1-carboxylate
(7-carbamoyl-2,3-dimethyl-1H-indol-4-yl) piperidine-1-carboxylate (PubChem CID 140777261) has the molecular formula C17H21N3O3
and a molecular weight of 315.37 g/mol. Its IUPAC name is (7-carbamoyl-2,3-dimethyl-1H-indol-4-yl) piperidine-1-carboxylate.
Molecular Properties
| Compound Name | (7-carbamoyl-2,3-dimethyl-1H-indol-4-yl) piperidine-1-carboxylate |
| PubChem CID | 140777261 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | (7-carbamoyl-2,3-dimethyl-1H-indol-4-yl) piperidine-1-carboxylate |
| SMILES | Cc1[nH]c2c(C(N)=O)ccc(OC(=O)N3CCCCC3)c2c1C |
| InChI | InChI=1S/C17H21N3O3/c1-10-11(2)19-15-12(16(18)21)6-7-13(14(10)15)23-17(22)20-8-4-3-5-9-20/h6-7,19H,3-5,8-9H2,1-2H3,(H2,18,21) |
| InChIKey | QCHFGUYOKUMQIB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (7-carbamoyl-2,3-dimethyl-1H-indol-4-yl) piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-carbamoyl-2,3-dimethyl-1H-indol-4-yl) piperidine-1-carboxylate?
The IUPAC name of (7-carbamoyl-2,3-dimethyl-1H-indol-4-yl) piperidine-1-carboxylate (CID 140777261) is (7-carbamoyl-2,3-dimethyl-1H-indol-4-yl) piperidine-1-carboxylate.
What is the SMILES notation for (7-carbamoyl-2,3-dimethyl-1H-indol-4-yl) piperidine-1-carboxylate?
The canonical SMILES for (7-carbamoyl-2,3-dimethyl-1H-indol-4-yl) piperidine-1-carboxylate is Cc1[nH]c2c(C(N)=O)ccc(OC(=O)N3CCCCC3)c2c1C.
What is the InChIKey of (7-carbamoyl-2,3-dimethyl-1H-indol-4-yl) piperidine-1-carboxylate?
The InChIKey is QCHFGUYOKUMQIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3O3/c1-10-11(2)19-15-12(16(18)21)6-7-13(14(10)15)23-17(22)20-8-4-3-5-9-20/h6-7,19H,3-5,8-9H2,1-2H3,(H2,18,21).
What are the key properties of (7-carbamoyl-2,3-dimethyl-1H-indol-4-yl) piperidine-1-carboxylate?
(7-carbamoyl-2,3-dimethyl-1H-indol-4-yl) piperidine-1-carboxylate has a molecular weight of 315.37 g/mol, XLogP of 2.87, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (7-carbamoyl-2,3-dimethyl-1H-indol-4-yl) piperidine-1-carboxylate is sourced from PubChem (CID 140777261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).