C19H25FO2 — CID 14077737
(2R,8R,9S,10R,13S,14S)-2-fluoro-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 14077737) has the molecular formula C19H25FO2 and a molecular weight of 304.40 g/mol. Its IUPAC name is (2R,8R,9S,10R,13S,14S)-2-fluoro-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (2R,8R,9S,10R,13S,14S)-2-fluoro-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 14077737 |
| Molecular Formula | C19H25FO2 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | (2R,8R,9S,10R,13S,14S)-2-fluoro-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C[C@]12C[C@@H](F)C(=O)C=C1CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C19H25FO2/c1-18-8-7-14-12(13(18)5-6-17(18)22)4-3-11-9-16(21)15(20)10-19(11,14)2/h9,12-15H,3-8,10H2,1-2H3/t12-,13-,14-,15+,18-,19-/m0/s1 |
| InChIKey | PNXPHISPHTZOEA-YOTXKYLOSA-N |
| XLogP | 4.04 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |