C40H44FNO4Si — CID 140777651
(4R)-3-[(3R)-3-[4-[tert-butyl(diphenyl)silyl]oxycyclohexyl]-3-(4-fluorophenyl)propanoyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 140777651) has the molecular formula C40H44FNO4Si and a molecular weight of 649.88 g/mol. Its IUPAC name is (4R)-3-[(3R)-3-[4-[tert-butyl(diphenyl)silyl]oxycyclohexyl]-3-(4-fluorophenyl)propanoyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-[(3R)-3-[4-[tert-butyl(diphenyl)silyl]oxycyclohexyl]-3-(4-fluorophenyl)propanoyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 140777651 |
| Molecular Formula | C40H44FNO4Si |
| Molecular Weight | 649.88 g/mol |
| Exact Mass | 649.30 |
| IUPAC Name | (4R)-3-[(3R)-3-[4-[tert-butyl(diphenyl)silyl]oxycyclohexyl]-3-(4-fluorophenyl)propanoyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | CC(C)(C)[Si](OC1CCC([C@@H](CC(=O)N2C(=O)OC[C@H]2c2ccccc2)c2ccc(F)cc2)CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H44FNO4Si/c1-40(2,3)47(34-15-9-5-10-16-34,35-17-11-6-12-18-35)46-33-25-21-30(22-26-33)36(29-19-23-32(41)24-20-29)27-38(43)42-37(28-45-39(42)44)31-13-7-4-8-14-31/h4-20,23-24,30,33,36-37H,21-22,25-28H2,1-3H3/t30?,33?,36-,37-/m0/s1 |
| InChIKey | AJFNDFNQUIVZCJ-CABZQHEVSA-N |
| XLogP | 8.15 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.88 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|