C29H40BN5O7 — CID 140778407
tert-butyl 3-[(2R)-2-[[2-(3-carbamoyl-1,2,4-triazol-1-yl)acetyl]amino]-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-methoxybenzoate (PubChem CID 140778407) has the molecular formula C29H40BN5O7 and a molecular weight of 581.48 g/mol. Its IUPAC name is tert-butyl 3-[(2R)-2-[[2-(3-carbamoyl-1,2,4-triazol-1-yl)acetyl]amino]-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-methoxybenzoate.
| Compound Name | tert-butyl 3-[(2R)-2-[[2-(3-carbamoyl-1,2,4-triazol-1-yl)acetyl]amino]-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-methoxybenzoate |
|---|---|
| PubChem CID | 140778407 |
| Molecular Formula | C29H40BN5O7 |
| Molecular Weight | 581.48 g/mol |
| Exact Mass | 581.30 |
| IUPAC Name | tert-butyl 3-[(2R)-2-[[2-(3-carbamoyl-1,2,4-triazol-1-yl)acetyl]amino]-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-methoxybenzoate |
| SMILES | COc1c(C[C@H](NC(=O)Cn2cnc(C(N)=O)n2)B2O[C@@H]3C[C@@H]4C[C@@H](C4(C)C)[C@]3(C)O2)cccc1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H40BN5O7/c1-27(2,3)40-26(38)18-10-8-9-16(23(18)39-7)11-21(33-22(36)14-35-15-32-25(34-35)24(31)37)30-41-20-13-17-12-19(28(17,4)5)29(20,6)42-30/h8-10,15,17,19-21H,11-14H2,1-7H3,(H2,31,37)(H,33,36)/t17-,19-,20+,21-,29-/m0/s1 |
| InChIKey | SWQIPYPXGZDJHS-AJLAKWFKSA-N |
| XLogP | 2.34 |
| TPSA | 156.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.48 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|