C21H19N5O — CID 140778496
3-[(1-cyclopentyl-8-isocyanoimidazo[4,5-c]quinolin-2-yl)methyl]-5-methyl-1,2-oxazole (PubChem CID 140778496) has the molecular formula C21H19N5O and a molecular weight of 357.42 g/mol. Its IUPAC name is 3-[(1-cyclopentyl-8-isocyanoimidazo[4,5-c]quinolin-2-yl)methyl]-5-methyl-1,2-oxazole.
| Compound Name | 3-[(1-cyclopentyl-8-isocyanoimidazo[4,5-c]quinolin-2-yl)methyl]-5-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 140778496 |
| Molecular Formula | C21H19N5O |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 3-[(1-cyclopentyl-8-isocyanoimidazo[4,5-c]quinolin-2-yl)methyl]-5-methyl-1,2-oxazole |
| SMILES | [C-]#[N+]c1ccc2ncc3nc(Cc4cc(C)on4)n(C4CCCC4)c3c2c1 |
| InChI | InChI=1S/C21H19N5O/c1-13-9-15(25-27-13)11-20-24-19-12-23-18-8-7-14(22-2)10-17(18)21(19)26(20)16-5-3-4-6-16/h7-10,12,16H,3-6,11H2,1H3 |
| InChIKey | BVCJKBKOLSLZLU-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 61.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|