C23H23N5O2 — CID 140778523
4-[8-isocyano-2-[(5-methyl-1,2-oxazol-3-yl)methyl]imidazo[4,5-c]quinolin-1-yl]-1-methylcyclohexan-1-ol (PubChem CID 140778523) has the molecular formula C23H23N5O2 and a molecular weight of 401.47 g/mol. Its IUPAC name is 4-[8-isocyano-2-[(5-methyl-1,2-oxazol-3-yl)methyl]imidazo[4,5-c]quinolin-1-yl]-1-methylcyclohexan-1-ol.
| Compound Name | 4-[8-isocyano-2-[(5-methyl-1,2-oxazol-3-yl)methyl]imidazo[4,5-c]quinolin-1-yl]-1-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 140778523 |
| Molecular Formula | C23H23N5O2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 4-[8-isocyano-2-[(5-methyl-1,2-oxazol-3-yl)methyl]imidazo[4,5-c]quinolin-1-yl]-1-methylcyclohexan-1-ol |
| SMILES | [C-]#[N+]c1ccc2ncc3nc(Cc4cc(C)on4)n(C4CCC(C)(O)CC4)c3c2c1 |
| InChI | InChI=1S/C23H23N5O2/c1-14-10-16(27-30-14)12-21-26-20-13-25-19-5-4-15(24-3)11-18(19)22(20)28(21)17-6-8-23(2,29)9-7-17/h4-5,10-11,13,17,29H,6-9,12H2,1-2H3 |
| InChIKey | RIDODXLQJQSTCJ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|