C21H18F4N4O2 — CID 140778569
2-[3-[(4R,5R,6S)-2-amino-6-(1,1-difluoroethyl)-5-fluoro-4-methyl-5,6-dihydro-1,3-oxazin-4-yl]-4-fluorophenyl]-1-(5-isocyano-2-pyridinyl)ethanone (PubChem CID 140778569) has the molecular formula C21H18F4N4O2 and a molecular weight of 434.39 g/mol. Its IUPAC name is 2-[3-[(4R,5R,6S)-2-amino-6-(1,1-difluoroethyl)-5-fluoro-4-methyl-5,6-dihydro-1,3-oxazin-4-yl]-4-fluorophenyl]-1-(5-isocyano-2-pyridinyl)ethanone.
| Compound Name | 2-[3-[(4R,5R,6S)-2-amino-6-(1,1-difluoroethyl)-5-fluoro-4-methyl-5,6-dihydro-1,3-oxazin-4-yl]-4-fluorophenyl]-1-(5-isocyano-2-pyridinyl)ethanone |
|---|---|
| PubChem CID | 140778569 |
| Molecular Formula | C21H18F4N4O2 |
| Molecular Weight | 434.39 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 2-[3-[(4R,5R,6S)-2-amino-6-(1,1-difluoroethyl)-5-fluoro-4-methyl-5,6-dihydro-1,3-oxazin-4-yl]-4-fluorophenyl]-1-(5-isocyano-2-pyridinyl)ethanone |
| SMILES | [C-]#[N+]c1ccc(C(=O)Cc2ccc(F)c([C@@]3(C)N=C(N)O[C@H](C(C)(F)F)[C@@H]3F)c2)nc1 |
| InChI | InChI=1S/C21H18F4N4O2/c1-20(17(23)18(21(2,24)25)31-19(26)29-20)13-8-11(4-6-14(13)22)9-16(30)15-7-5-12(27-3)10-28-15/h4-8,10,17-18H,9H2,1-2H3,(H2,26,29)/t17-,18-,20+/m0/s1 |
| InChIKey | VLBBLBOKEKGBQB-CMKODMSKSA-N |
| XLogP | 4.12 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.39 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|