C20H20F4N4O3 — CID 140778571
2-[3-[(4S,5R,6S)-2-amino-6-(difluoromethyl)-4,5-dimethyl-5,6-dihydro-1,3-oxazin-4-yl]-4-fluorophenyl]-1-[5-(fluoromethoxy)pyrazin-2-yl]ethanone (PubChem CID 140778571) has the molecular formula C20H20F4N4O3 and a molecular weight of 440.40 g/mol. Its IUPAC name is 2-[3-[(4S,5R,6S)-2-amino-6-(difluoromethyl)-4,5-dimethyl-5,6-dihydro-1,3-oxazin-4-yl]-4-fluorophenyl]-1-[5-(fluoromethoxy)pyrazin-2-yl]ethanone.
| Compound Name | 2-[3-[(4S,5R,6S)-2-amino-6-(difluoromethyl)-4,5-dimethyl-5,6-dihydro-1,3-oxazin-4-yl]-4-fluorophenyl]-1-[5-(fluoromethoxy)pyrazin-2-yl]ethanone |
|---|---|
| PubChem CID | 140778571 |
| Molecular Formula | C20H20F4N4O3 |
| Molecular Weight | 440.40 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 2-[3-[(4S,5R,6S)-2-amino-6-(difluoromethyl)-4,5-dimethyl-5,6-dihydro-1,3-oxazin-4-yl]-4-fluorophenyl]-1-[5-(fluoromethoxy)pyrazin-2-yl]ethanone |
| SMILES | C[C@H]1[C@@H](C(F)F)OC(N)=N[C@]1(C)c1cc(CC(=O)c2cnc(OCF)cn2)ccc1F |
| InChI | InChI=1S/C20H20F4N4O3/c1-10-17(18(23)24)31-19(25)28-20(10,2)12-5-11(3-4-13(12)22)6-15(29)14-7-27-16(8-26-14)30-9-21/h3-5,7-8,10,17-18H,6,9H2,1-2H3,(H2,25,28)/t10-,17-,20-/m0/s1 |
| InChIKey | CCQLEYJNBRMMLJ-DBYMYYNTSA-N |
| XLogP | 3.18 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |