C15H18N2O2 — CID 140778667
(9R)-4-isocyano-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13,13-diol (PubChem CID 140778667) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is (9R)-4-isocyano-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13,13-diol.
| Compound Name | (9R)-4-isocyano-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13,13-diol |
|---|---|
| PubChem CID | 140778667 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | (9R)-4-isocyano-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13,13-diol |
| SMILES | [C-]#[N+]c1ccc2c(c1)C1(C)CCN(C)[C@H](C2)C1(O)O |
| InChI | InChI=1S/C15H18N2O2/c1-14-6-7-17(3)13(15(14,18)19)8-10-4-5-11(16-2)9-12(10)14/h4-5,9,13,18-19H,6-8H2,1,3H3/t13-,14?/m1/s1 |
| InChIKey | MFILLQVTMDEACQ-KWCCSABGSA-N |
| XLogP | 1.44 |
| TPSA | 48.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|