About carbamoyl pyrazolo[1,5-a]pyrimidine-2-carboxylate
carbamoyl pyrazolo[1,5-a]pyrimidine-2-carboxylate (PubChem CID 140778817) has the molecular formula C8H6N4O3
and a molecular weight of 206.16 g/mol. Its IUPAC name is carbamoyl pyrazolo[1,5-a]pyrimidine-2-carboxylate.
Molecular Properties
| Compound Name | carbamoyl pyrazolo[1,5-a]pyrimidine-2-carboxylate |
| PubChem CID | 140778817 |
| Molecular Formula | C8H6N4O3 |
| Molecular Weight | 206.16 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | carbamoyl pyrazolo[1,5-a]pyrimidine-2-carboxylate |
| SMILES | NC(=O)OC(=O)c1cc2ncccn2n1 |
| InChI | InChI=1S/C8H6N4O3/c9-8(14)15-7(13)5-4-6-10-2-1-3-12(6)11-5/h1-4H,(H2,9,14) |
| InChIKey | IRGLGARSNJXRGM-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 99.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.16 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze carbamoyl pyrazolo[1,5-a]pyrimidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamoyl pyrazolo[1,5-a]pyrimidine-2-carboxylate?
The IUPAC name of carbamoyl pyrazolo[1,5-a]pyrimidine-2-carboxylate (CID 140778817) is carbamoyl pyrazolo[1,5-a]pyrimidine-2-carboxylate.
What is the SMILES notation for carbamoyl pyrazolo[1,5-a]pyrimidine-2-carboxylate?
The canonical SMILES for carbamoyl pyrazolo[1,5-a]pyrimidine-2-carboxylate is NC(=O)OC(=O)c1cc2ncccn2n1.
What is the InChIKey of carbamoyl pyrazolo[1,5-a]pyrimidine-2-carboxylate?
The InChIKey is IRGLGARSNJXRGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N4O3/c9-8(14)15-7(13)5-4-6-10-2-1-3-12(6)11-5/h1-4H,(H2,9,14).
What are the key properties of carbamoyl pyrazolo[1,5-a]pyrimidine-2-carboxylate?
carbamoyl pyrazolo[1,5-a]pyrimidine-2-carboxylate has a molecular weight of 206.16 g/mol, XLogP of -0.04, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for carbamoyl pyrazolo[1,5-a]pyrimidine-2-carboxylate is sourced from PubChem (CID 140778817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).