C30H30FN3O2 — CID 140778987
2-[(1R)-1-[4-(6-fluoroquinolin-4-yl)cyclohexyl]ethyl]-4-(5-methoxy-2-pyridinyl)benzamide (PubChem CID 140778987) has the molecular formula C30H30FN3O2 and a molecular weight of 483.59 g/mol. Its IUPAC name is 2-[(1R)-1-[4-(6-fluoroquinolin-4-yl)cyclohexyl]ethyl]-4-(5-methoxy-2-pyridinyl)benzamide.
| Compound Name | 2-[(1R)-1-[4-(6-fluoroquinolin-4-yl)cyclohexyl]ethyl]-4-(5-methoxy-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 140778987 |
| Molecular Formula | C30H30FN3O2 |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | 2-[(1R)-1-[4-(6-fluoroquinolin-4-yl)cyclohexyl]ethyl]-4-(5-methoxy-2-pyridinyl)benzamide |
| SMILES | COc1ccc(-c2ccc(C(N)=O)c([C@H](C)C3CCC(c4ccnc5ccc(F)cc45)CC3)c2)nc1 |
| InChI | InChI=1S/C30H30FN3O2/c1-18(26-15-21(7-10-25(26)30(32)35)28-12-9-23(36-2)17-34-28)19-3-5-20(6-4-19)24-13-14-33-29-11-8-22(31)16-27(24)29/h7-20H,3-6H2,1-2H3,(H2,32,35)/t18-,19?,20?/m1/s1 |
| InChIKey | ZXIFNKSHSRIJRY-XEVCZEQESA-N |
| XLogP | 6.62 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |