C72H43N7 — CID 140779438
5-[4-[3,6-di(carbazol-9-yl)carbazol-9-yl]phenyl]-2-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]-4-isocyanobenzonitrile (PubChem CID 140779438) has the molecular formula C72H43N7 and a molecular weight of 1006.18 g/mol. Its IUPAC name is 5-[4-[3,6-di(carbazol-9-yl)carbazol-9-yl]phenyl]-2-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]-4-isocyanobenzonitrile.
| Compound Name | 5-[4-[3,6-di(carbazol-9-yl)carbazol-9-yl]phenyl]-2-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]-4-isocyanobenzonitrile |
|---|---|
| PubChem CID | 140779438 |
| Molecular Formula | C72H43N7 |
| Molecular Weight | 1006.18 g/mol |
| Exact Mass | 1005.36 |
| IUPAC Name | 5-[4-[3,6-di(carbazol-9-yl)carbazol-9-yl]phenyl]-2-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]-4-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1cc(-c2ccc(-c3cc(-c4ccccc4)nc(-c4ccccc4)n3)cc2)c(C#N)cc1-c1ccc(-n2c3ccc(-n4c5ccccc5c5ccccc54)cc3c3cc(-n4c5ccccc5c5ccccc54)ccc32)cc1 |
| InChI | InChI=1S/C72H43N7/c1-74-65-43-59(46-28-30-49(31-29-46)64-44-63(48-16-4-2-5-17-48)75-72(76-64)50-18-6-3-7-19-50)51(45-73)40-60(65)47-32-34-52(35-33-47)77-70-38-36-53(78-66-24-12-8-20-55(66)56-21-9-13-25-67(56)78)41-61(70)62-42-54(37-39-71(62)77)79-68-26-14-10-22-57(68)58-23-11-15-27-69(58)79/h2-44H |
| InChIKey | XLRVXLUSGNSZEA-UHFFFAOYSA-N |
| XLogP | 18.53 |
| TPSA | 68.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 79 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1006.18 |
| LogP ≤ 5 | 18.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|