About [dimethyl(trimethylsilyloxy)silyl] 2,2-dimethylbutanoate
[dimethyl(trimethylsilyloxy)silyl] 2,2-dimethylbutanoate (PubChem CID 140779882) has the molecular formula C11H26O3Si2
and a molecular weight of 262.50 g/mol. Its IUPAC name is [dimethyl(trimethylsilyloxy)silyl] 2,2-dimethylbutanoate.
Molecular Properties
| Compound Name | [dimethyl(trimethylsilyloxy)silyl] 2,2-dimethylbutanoate |
| PubChem CID | 140779882 |
| Molecular Formula | C11H26O3Si2 |
| Molecular Weight | 262.50 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | [dimethyl(trimethylsilyloxy)silyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C11H26O3Si2/c1-9-11(2,3)10(12)13-16(7,8)14-15(4,5)6/h9H2,1-8H3 |
| InChIKey | ZBCXTMMFSCPKNB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [dimethyl(trimethylsilyloxy)silyl] 2,2-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [dimethyl(trimethylsilyloxy)silyl] 2,2-dimethylbutanoate?
The IUPAC name of [dimethyl(trimethylsilyloxy)silyl] 2,2-dimethylbutanoate (CID 140779882) is [dimethyl(trimethylsilyloxy)silyl] 2,2-dimethylbutanoate.
What is the SMILES notation for [dimethyl(trimethylsilyloxy)silyl] 2,2-dimethylbutanoate?
The canonical SMILES for [dimethyl(trimethylsilyloxy)silyl] 2,2-dimethylbutanoate is CCC(C)(C)C(=O)O[Si](C)(C)O[Si](C)(C)C.
What is the InChIKey of [dimethyl(trimethylsilyloxy)silyl] 2,2-dimethylbutanoate?
The InChIKey is ZBCXTMMFSCPKNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H26O3Si2/c1-9-11(2,3)10(12)13-16(7,8)14-15(4,5)6/h9H2,1-8H3.
What are the key properties of [dimethyl(trimethylsilyloxy)silyl] 2,2-dimethylbutanoate?
[dimethyl(trimethylsilyloxy)silyl] 2,2-dimethylbutanoate has a molecular weight of 262.50 g/mol, XLogP of 3.52, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [dimethyl(trimethylsilyloxy)silyl] 2,2-dimethylbutanoate is sourced from PubChem (CID 140779882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).